C15H15BrN2S — CID 83987534
2-(5-bromothiophen-2-yl)-2-(5-methyl-1H-indol-3-yl)ethanamine (PubChem CID 83987534) has the molecular formula C15H15BrN2S and a molecular weight of 335.27 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-2-(5-methyl-1H-indol-3-yl)ethanamine.
| Compound Name | 2-(5-bromothiophen-2-yl)-2-(5-methyl-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 83987534 |
| Molecular Formula | C15H15BrN2S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-2-(5-methyl-1H-indol-3-yl)ethanamine |
| SMILES | Cc1ccc2[nH]cc(C(CN)c3ccc(Br)s3)c2c1 |
| InChI | InChI=1S/C15H15BrN2S/c1-9-2-3-13-10(6-9)12(8-18-13)11(7-17)14-4-5-15(16)19-14/h2-6,8,11,18H,7,17H2,1H3 |
| InChIKey | QOAOAVTUEMSTNB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |