C16H22BrNO2 — CID 83988808
1-[2-bromo-5-(2-methylpropoxy)phenyl]-2-pyrrolidin-1-ylethanone (PubChem CID 83988808) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is 1-[2-bromo-5-(2-methylpropoxy)phenyl]-2-pyrrolidin-1-ylethanone.
| Compound Name | 1-[2-bromo-5-(2-methylpropoxy)phenyl]-2-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 83988808 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 1-[2-bromo-5-(2-methylpropoxy)phenyl]-2-pyrrolidin-1-ylethanone |
| SMILES | CC(C)COc1ccc(Br)c(C(=O)CN2CCCC2)c1 |
| InChI | InChI=1S/C16H22BrNO2/c1-12(2)11-20-13-5-6-15(17)14(9-13)16(19)10-18-7-3-4-8-18/h5-6,9,12H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | SHSBXNVMKFQBNX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |