C11H25N3O — CID 83989506
1-[5-amino-1-(2-aminoethyl)piperidin-3-yl]butan-2-ol (PubChem CID 83989506) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-[5-amino-1-(2-aminoethyl)piperidin-3-yl]butan-2-ol.
| Compound Name | 1-[5-amino-1-(2-aminoethyl)piperidin-3-yl]butan-2-ol |
|---|---|
| PubChem CID | 83989506 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 1-[5-amino-1-(2-aminoethyl)piperidin-3-yl]butan-2-ol |
| SMILES | CCC(O)CC1CC(N)CN(CCN)C1 |
| InChI | InChI=1S/C11H25N3O/c1-2-11(15)6-9-5-10(13)8-14(7-9)4-3-12/h9-11,15H,2-8,12-13H2,1H3 |
| InChIKey | JNOJISWJYKINAY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |