C18H30N2 — CID 83995173
1-(3,4-dimethylphenyl)-N-(2,2-dimethylpropyl)piperidin-3-amine (PubChem CID 83995173) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-N-(2,2-dimethylpropyl)piperidin-3-amine.
| Compound Name | 1-(3,4-dimethylphenyl)-N-(2,2-dimethylpropyl)piperidin-3-amine |
|---|---|
| PubChem CID | 83995173 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-N-(2,2-dimethylpropyl)piperidin-3-amine |
| SMILES | Cc1ccc(N2CCCC(NCC(C)(C)C)C2)cc1C |
| InChI | InChI=1S/C18H30N2/c1-14-8-9-17(11-15(14)2)20-10-6-7-16(12-20)19-13-18(3,4)5/h8-9,11,16,19H,6-7,10,12-13H2,1-5H3 |
| InChIKey | ARZFLDWWFZPZHG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|