C15H29N3O3 — CID 83996201
1-(2-acetamidoethyl)-5-(3-methylbutylamino)piperidine-3-carboxylic acid (PubChem CID 83996201) has the molecular formula C15H29N3O3 and a molecular weight of 299.41 g/mol. Its IUPAC name is 1-(2-acetamidoethyl)-5-(3-methylbutylamino)piperidine-3-carboxylic acid.
| Compound Name | 1-(2-acetamidoethyl)-5-(3-methylbutylamino)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 83996201 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 1-(2-acetamidoethyl)-5-(3-methylbutylamino)piperidine-3-carboxylic acid |
| SMILES | CC(=O)NCCN1CC(NCCC(C)C)CC(C(=O)O)C1 |
| InChI | InChI=1S/C15H29N3O3/c1-11(2)4-5-17-14-8-13(15(20)21)9-18(10-14)7-6-16-12(3)19/h11,13-14,17H,4-10H2,1-3H3,(H,16,19)(H,20,21) |
| InChIKey | VFRDEZPGOAWSEA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |