C16H29N3O3 — CID 83999658
1-(2-acetamidoethyl)-5-(cyclohexylamino)piperidine-3-carboxylic acid (PubChem CID 83999658) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-(2-acetamidoethyl)-5-(cyclohexylamino)piperidine-3-carboxylic acid.
| Compound Name | 1-(2-acetamidoethyl)-5-(cyclohexylamino)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 83999658 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 1-(2-acetamidoethyl)-5-(cyclohexylamino)piperidine-3-carboxylic acid |
| SMILES | CC(=O)NCCN1CC(NC2CCCCC2)CC(C(=O)O)C1 |
| InChI | InChI=1S/C16H29N3O3/c1-12(20)17-7-8-19-10-13(16(21)22)9-15(11-19)18-14-5-3-2-4-6-14/h13-15,18H,2-11H2,1H3,(H,17,20)(H,21,22) |
| InChIKey | SEJSVTNFUNPCFJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |