C17H34N2O — CID 83998440
2-[5-(cyclohexylmethylamino)-1-propan-2-ylpiperidin-3-yl]ethanol (PubChem CID 83998440) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is 2-[5-(cyclohexylmethylamino)-1-propan-2-ylpiperidin-3-yl]ethanol.
| Compound Name | 2-[5-(cyclohexylmethylamino)-1-propan-2-ylpiperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 83998440 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 2-[5-(cyclohexylmethylamino)-1-propan-2-ylpiperidin-3-yl]ethanol |
| SMILES | CC(C)N1CC(CCO)CC(NCC2CCCCC2)C1 |
| InChI | InChI=1S/C17H34N2O/c1-14(2)19-12-16(8-9-20)10-17(13-19)18-11-15-6-4-3-5-7-15/h14-18,20H,3-13H2,1-2H3 |
| InChIKey | VKRXEZJPEHFHSY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |