C21H34N2 — CID 83998453
N-(cyclohexylmethyl)-5-phenyl-1-propan-2-ylpiperidin-3-amine (PubChem CID 83998453) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-5-phenyl-1-propan-2-ylpiperidin-3-amine.
| Compound Name | N-(cyclohexylmethyl)-5-phenyl-1-propan-2-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 83998453 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | N-(cyclohexylmethyl)-5-phenyl-1-propan-2-ylpiperidin-3-amine |
| SMILES | CC(C)N1CC(NCC2CCCCC2)CC(c2ccccc2)C1 |
| InChI | InChI=1S/C21H34N2/c1-17(2)23-15-20(19-11-7-4-8-12-19)13-21(16-23)22-14-18-9-5-3-6-10-18/h4,7-8,11-12,17-18,20-22H,3,5-6,9-10,13-16H2,1-2H3 |
| InChIKey | ALRLSPWGEOUZTJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |