C18H32N2O2 — CID 83999520
3-[3-(cyclohexylamino)-5-(cyclopropylmethyl)piperidin-1-yl]propanoic acid (PubChem CID 83999520) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 3-[3-(cyclohexylamino)-5-(cyclopropylmethyl)piperidin-1-yl]propanoic acid.
| Compound Name | 3-[3-(cyclohexylamino)-5-(cyclopropylmethyl)piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 83999520 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 3-[3-(cyclohexylamino)-5-(cyclopropylmethyl)piperidin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CC(CC2CC2)CC(NC2CCCCC2)C1 |
| InChI | InChI=1S/C18H32N2O2/c21-18(22)8-9-20-12-15(10-14-6-7-14)11-17(13-20)19-16-4-2-1-3-5-16/h14-17,19H,1-13H2,(H,21,22) |
| InChIKey | YIECDNJPTOBSKF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |