C5H9F2NO — CID 84072741
(4,4-Difluoropyrrolidin-3-yl)methanol (PubChem CID 84072741) has the molecular formula C5H9F2NO and a molecular weight of 137.13 g/mol. Its IUPAC name is (4,4-difluoropyrrolidin-3-yl)methanol.
| Compound Name | (4,4-Difluoropyrrolidin-3-yl)methanol |
|---|---|
| PubChem CID | 84072741 |
| Molecular Formula | C5H9F2NO |
| Molecular Weight | 137.13 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | (4,4-difluoropyrrolidin-3-yl)methanol |
| SMILES | C1C(C(CN1)(F)F)CO |
| InChI | InChI=1S/C5H9F2NO/c6-5(7)3-8-1-4(5)2-9/h4,8-9H,1-3H2 |
| InChIKey | KZCQPDDTALRRBM-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 32.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | 107 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.13 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |