C11H14AsNO3S2 — CID 8414
N-[2-hydroxy-5-[4-(hydroxymethyl)-1,3,2-dithiarsolan-2-yl]phenyl]acetamide (PubChem CID 8414) has the molecular formula C11H14AsNO3S2 and a molecular weight of 347.29 g/mol. Its IUPAC name is N-[2-hydroxy-5-[4-(hydroxymethyl)-1,3,2-dithiarsolan-2-yl]phenyl]acetamide.
| Compound Name | N-[2-hydroxy-5-[4-(hydroxymethyl)-1,3,2-dithiarsolan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 8414 |
| Molecular Formula | C11H14AsNO3S2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | N-[2-hydroxy-5-[4-(hydroxymethyl)-1,3,2-dithiarsolan-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc([As]2SCC(CO)S2)ccc1O |
| InChI | InChI=1S/C11H14AsNO3S2/c1-7(15)13-10-4-8(2-3-11(10)16)12-17-6-9(5-14)18-12/h2-4,9,14,16H,5-6H2,1H3,(H,13,15) |
| InChIKey | MRUDSZSRLQAPOG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|