C11H7N3O2S — CID 843653
3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)indol-2-one (PubChem CID 843653) has the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. Its IUPAC name is 3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)indol-2-one.
| Compound Name | 3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)indol-2-one |
|---|---|
| PubChem CID | 843653 |
| Molecular Formula | C11H7N3O2S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)indol-2-one |
| SMILES | Nc1nc(O)c(C2=c3ccccc3=NC2=O)s1 |
| InChI | InChI=1S/C11H7N3O2S/c12-11-14-10(16)8(17-11)7-5-3-1-2-4-6(5)13-9(7)15/h1-4,16H,(H2,12,14) |
| InChIKey | PEVMZPPUCLFWJM-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |