C18H28O3S — CID 8442
5-(2-octylsulfinylpropyl)-1,3-benzodioxole (PubChem CID 8442) has the molecular formula C18H28O3S and a molecular weight of 324.49 g/mol. Its IUPAC name is 5-(2-octylsulfinylpropyl)-1,3-benzodioxole.
| Compound Name | 5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 8442 |
| Molecular Formula | C18H28O3S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
| SMILES | CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H28O3S/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17/h9-10,13,15H,3-8,11-12,14H2,1-2H3 |
| InChIKey | ATTZFSUZZUNHBP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|