C20H23N5O — CID 844520
(E)-N-[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]-3-(1-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 844520) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is (E)-N-[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]-3-(1-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]-3-(1-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 844520 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | (E)-N-[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]-3-(1-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1ccccc1Cn1nc(C)c(NC(=O)/C=C/c2cnn(C)c2)c1C |
| InChI | InChI=1S/C20H23N5O/c1-14-7-5-6-8-18(14)13-25-16(3)20(15(2)23-25)22-19(26)10-9-17-11-21-24(4)12-17/h5-12H,13H2,1-4H3,(H,22,26)/b10-9+ |
| InChIKey | JZOQFOYLZHULMT-MDZDMXLPSA-N |
| XLogP | 3.24 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|