C12H18ClN3O — CID 844749
azepan-1-yl-(4-chloro-1,5-dimethylpyrazol-3-yl)methanone (PubChem CID 844749) has the molecular formula C12H18ClN3O and a molecular weight of 255.75 g/mol. Its IUPAC name is azepan-1-yl-(4-chloro-1,5-dimethylpyrazol-3-yl)methanone.
| Compound Name | azepan-1-yl-(4-chloro-1,5-dimethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 844749 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | azepan-1-yl-(4-chloro-1,5-dimethylpyrazol-3-yl)methanone |
| SMILES | Cc1c(Cl)c(C(=O)N2CCCCCC2)nn1C |
| InChI | InChI=1S/C12H18ClN3O/c1-9-10(13)11(14-15(9)2)12(17)16-7-5-3-4-6-8-16/h3-8H2,1-2H3 |
| InChIKey | LDSSYYOOINGJFN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |