C17H24N2O2 — CID 84546564
1-(2,4-dimethylbenzoyl)-N,N-dimethylpiperidine-4-carboxamide (PubChem CID 84546564) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-(2,4-dimethylbenzoyl)-N,N-dimethylpiperidine-4-carboxamide.
| Compound Name | 1-(2,4-dimethylbenzoyl)-N,N-dimethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 84546564 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-(2,4-dimethylbenzoyl)-N,N-dimethylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCC(C(=O)N(C)C)CC2)c(C)c1 |
| InChI | InChI=1S/C17H24N2O2/c1-12-5-6-15(13(2)11-12)17(21)19-9-7-14(8-10-19)16(20)18(3)4/h5-6,11,14H,7-10H2,1-4H3 |
| InChIKey | IVMKCRGHCDQUKI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |