C18H14BrN3O3S — CID 84550351
N-(2-bromophenyl)-2-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 84550351) has the molecular formula C18H14BrN3O3S and a molecular weight of 432.30 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-bromophenyl)-2-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 84550351 |
| Molecular Formula | C18H14BrN3O3S |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | N-(2-bromophenyl)-2-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2nc(C(=O)Nc3ccccc3Br)cs2)cc1 |
| InChI | InChI=1S/C18H14BrN3O3S/c1-25-12-8-6-11(7-9-12)16(23)22-18-21-15(10-26-18)17(24)20-14-5-3-2-4-13(14)19/h2-10H,1H3,(H,20,24)(H,21,22,23) |
| InChIKey | HQFHDMHRBZPKDN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |