C18H13ClN4O5S — CID 84550498
N-(4-chloro-2-nitrophenyl)-2-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 84550498) has the molecular formula C18H13ClN4O5S and a molecular weight of 432.85 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-2-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-2-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 84550498 |
| Molecular Formula | C18H13ClN4O5S |
| Molecular Weight | 432.85 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-2-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2nc(C(=O)Nc3ccc(Cl)cc3[N+](=O)[O-])cs2)cc1 |
| InChI | InChI=1S/C18H13ClN4O5S/c1-28-12-5-2-10(3-6-12)16(24)22-18-21-14(9-29-18)17(25)20-13-7-4-11(19)8-15(13)23(26)27/h2-9H,1H3,(H,20,25)(H,21,22,24) |
| InChIKey | MAASMVHPFNSBPN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|