C19H22N2O4 — CID 84551886
methyl 1-(4-indol-1-yl-4-oxobutanoyl)piperidine-4-carboxylate (PubChem CID 84551886) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is methyl 1-(4-indol-1-yl-4-oxobutanoyl)piperidine-4-carboxylate.
| Compound Name | methyl 1-(4-indol-1-yl-4-oxobutanoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 84551886 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | methyl 1-(4-indol-1-yl-4-oxobutanoyl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CCC(=O)n2ccc3ccccc32)CC1 |
| InChI | InChI=1S/C19H22N2O4/c1-25-19(24)15-8-11-20(12-9-15)17(22)6-7-18(23)21-13-10-14-4-2-3-5-16(14)21/h2-5,10,13,15H,6-9,11-12H2,1H3 |
| InChIKey | BZRVIBQQGCGPQL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |