C20H24N2O4 — CID 84553269
ethyl 1-(4-indol-1-yl-4-oxobutanoyl)piperidine-3-carboxylate (PubChem CID 84553269) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is ethyl 1-(4-indol-1-yl-4-oxobutanoyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(4-indol-1-yl-4-oxobutanoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 84553269 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | ethyl 1-(4-indol-1-yl-4-oxobutanoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)CCC(=O)n2ccc3ccccc32)C1 |
| InChI | InChI=1S/C20H24N2O4/c1-2-26-20(25)16-7-5-12-21(14-16)18(23)9-10-19(24)22-13-11-15-6-3-4-8-17(15)22/h3-4,6,8,11,13,16H,2,5,7,9-10,12,14H2,1H3 |
| InChIKey | VDAHGUQYAPCDGZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |