C18H14Cl2N2O2 — CID 84552815
N-(3,4-dichlorophenyl)-4-indol-1-yl-4-oxobutanamide (PubChem CID 84552815) has the molecular formula C18H14Cl2N2O2 and a molecular weight of 361.23 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-indol-1-yl-4-oxobutanamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-indol-1-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 84552815 |
| Molecular Formula | C18H14Cl2N2O2 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-indol-1-yl-4-oxobutanamide |
| SMILES | O=C(CCC(=O)n1ccc2ccccc21)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2N2O2/c19-14-6-5-13(11-15(14)20)21-17(23)7-8-18(24)22-10-9-12-3-1-2-4-16(12)22/h1-6,9-11H,7-8H2,(H,21,23) |
| InChIKey | BOWZNCASSWDIDE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |