C17H14F3N3O — CID 84554029
3-indol-1-yl-N-[5-(trifluoromethyl)-2-pyridinyl]propanamide (PubChem CID 84554029) has the molecular formula C17H14F3N3O and a molecular weight of 333.31 g/mol. Its IUPAC name is 3-indol-1-yl-N-[5-(trifluoromethyl)-2-pyridinyl]propanamide.
| Compound Name | 3-indol-1-yl-N-[5-(trifluoromethyl)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 84554029 |
| Molecular Formula | C17H14F3N3O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-indol-1-yl-N-[5-(trifluoromethyl)-2-pyridinyl]propanamide |
| SMILES | O=C(CCn1ccc2ccccc21)Nc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H14F3N3O/c18-17(19,20)13-5-6-15(21-11-13)22-16(24)8-10-23-9-7-12-3-1-2-4-14(12)23/h1-7,9,11H,8,10H2,(H,21,22,24) |
| InChIKey | XCNHLQYVYRFHBG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |