C14H23N3O4 — CID 84555533
N-(3-butoxypropyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-carboxamide (PubChem CID 84555533) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-(3-butoxypropyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-carboxamide.
| Compound Name | N-(3-butoxypropyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 84555533 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-(3-butoxypropyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-carboxamide |
| SMILES | CCCCOCCCNC(=O)c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H23N3O4/c1-4-5-8-21-9-6-7-15-12(18)11-10-16(2)14(20)17(3)13(11)19/h10H,4-9H2,1-3H3,(H,15,18) |
| InChIKey | NQSUCUCMESEJEZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|