C20H21NO4 — CID 84556507
1-(5-acetyl-2,3-dihydroindol-1-yl)-2-(2,4-dimethoxyphenyl)ethanone (PubChem CID 84556507) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-(5-acetyl-2,3-dihydroindol-1-yl)-2-(2,4-dimethoxyphenyl)ethanone.
| Compound Name | 1-(5-acetyl-2,3-dihydroindol-1-yl)-2-(2,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 84556507 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-(5-acetyl-2,3-dihydroindol-1-yl)-2-(2,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CCc3cc(C(C)=O)ccc32)c(OC)c1 |
| InChI | InChI=1S/C20H21NO4/c1-13(22)14-5-7-18-15(10-14)8-9-21(18)20(23)11-16-4-6-17(24-2)12-19(16)25-3/h4-7,10,12H,8-9,11H2,1-3H3 |
| InChIKey | JQSZEGDEIIFNKH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |