C19H19NO4 — CID 110737370
1-(5-acetyl-2,3-dihydroindol-1-yl)-2-(2-methoxyphenoxy)ethanone (PubChem CID 110737370) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 1-(5-acetyl-2,3-dihydroindol-1-yl)-2-(2-methoxyphenoxy)ethanone.
| Compound Name | 1-(5-acetyl-2,3-dihydroindol-1-yl)-2-(2-methoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 110737370 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-(5-acetyl-2,3-dihydroindol-1-yl)-2-(2-methoxyphenoxy)ethanone |
| SMILES | COc1ccccc1OCC(=O)N1CCc2cc(C(C)=O)ccc21 |
| InChI | InChI=1S/C19H19NO4/c1-13(21)14-7-8-16-15(11-14)9-10-20(16)19(22)12-24-18-6-4-3-5-17(18)23-2/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | FFZWLAOUYRWIQM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |