C17H20N2O4 — CID 84556826
2-[(4-indol-1-yl-4-oxobutanoyl)amino]pentanoic acid (PubChem CID 84556826) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-[(4-indol-1-yl-4-oxobutanoyl)amino]pentanoic acid.
| Compound Name | 2-[(4-indol-1-yl-4-oxobutanoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 84556826 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-[(4-indol-1-yl-4-oxobutanoyl)amino]pentanoic acid |
| SMILES | CCCC(NC(=O)CCC(=O)n1ccc2ccccc21)C(=O)O |
| InChI | InChI=1S/C17H20N2O4/c1-2-5-13(17(22)23)18-15(20)8-9-16(21)19-11-10-12-6-3-4-7-14(12)19/h3-4,6-7,10-11,13H,2,5,8-9H2,1H3,(H,18,20)(H,22,23) |
| InChIKey | NJROCVKUNICASB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |