C15H30N2O5S — CID 84558313
tert-butyl N-[2-[2-[bis(2-methoxyethyl)amino]-2-oxoethyl]sulfanylethyl]carbamate (PubChem CID 84558313) has the molecular formula C15H30N2O5S and a molecular weight of 350.48 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[bis(2-methoxyethyl)amino]-2-oxoethyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[bis(2-methoxyethyl)amino]-2-oxoethyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 84558313 |
| Molecular Formula | C15H30N2O5S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | tert-butyl N-[2-[2-[bis(2-methoxyethyl)amino]-2-oxoethyl]sulfanylethyl]carbamate |
| SMILES | COCCN(CCOC)C(=O)CSCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N2O5S/c1-15(2,3)22-14(19)16-6-11-23-12-13(18)17(7-9-20-4)8-10-21-5/h6-12H2,1-5H3,(H,16,19) |
| InChIKey | SWJSRORXHHPPSY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|