C25H32N2O4 — CID 84559276
(E)-N-[4-(1-hydroxy-3-morpholin-4-ylpropyl)phenyl]-3-(3-propan-2-yloxyphenyl)prop-2-enamide (PubChem CID 84559276) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is (E)-N-[4-(1-hydroxy-3-morpholin-4-ylpropyl)phenyl]-3-(3-propan-2-yloxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(1-hydroxy-3-morpholin-4-ylpropyl)phenyl]-3-(3-propan-2-yloxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 84559276 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (E)-N-[4-(1-hydroxy-3-morpholin-4-ylpropyl)phenyl]-3-(3-propan-2-yloxyphenyl)prop-2-enamide |
| SMILES | CC(C)Oc1cccc(/C=C/C(=O)Nc2ccc(C(O)CCN3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C25H32N2O4/c1-19(2)31-23-5-3-4-20(18-23)6-11-25(29)26-22-9-7-21(8-10-22)24(28)12-13-27-14-16-30-17-15-27/h3-11,18-19,24,28H,12-17H2,1-2H3,(H,26,29)/b11-6+ |
| InChIKey | FFSWMWUVAANZIW-IZZDOVSWSA-N |
| XLogP | 3.88 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|