C18H13F3N2O3S2 — CID 84560238
ethyl 4-phenyl-2-[[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 84560238) has the molecular formula C18H13F3N2O3S2 and a molecular weight of 426.44 g/mol. Its IUPAC name is ethyl 4-phenyl-2-[[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-phenyl-2-[[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 84560238 |
| Molecular Formula | C18H13F3N2O3S2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | ethyl 4-phenyl-2-[[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)c1scnc1C(F)(F)F |
| InChI | InChI=1S/C18H13F3N2O3S2/c1-2-26-17(25)12-11(10-6-4-3-5-7-10)8-27-16(12)23-15(24)13-14(18(19,20)21)22-9-28-13/h3-9H,2H2,1H3,(H,23,24) |
| InChIKey | KSMBLDLSFPIMGQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|