C19H22N2O6S — CID 84560980
ethyl 4,5-dimethyl-2-[4-(2-nitrophenoxy)butanoylamino]thiophene-3-carboxylate (PubChem CID 84560980) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is ethyl 4,5-dimethyl-2-[4-(2-nitrophenoxy)butanoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4,5-dimethyl-2-[4-(2-nitrophenoxy)butanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 84560980 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | ethyl 4,5-dimethyl-2-[4-(2-nitrophenoxy)butanoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCCOc2ccccc2[N+](=O)[O-])sc(C)c1C |
| InChI | InChI=1S/C19H22N2O6S/c1-4-26-19(23)17-12(2)13(3)28-18(17)20-16(22)10-7-11-27-15-9-6-5-8-14(15)21(24)25/h5-6,8-9H,4,7,10-11H2,1-3H3,(H,20,22) |
| InChIKey | RKTWOBHIQYZWSD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|