C23H24N2O4S — CID 84561256
ethyl 2-[(4-indol-1-yl-4-oxobutanoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 84561256) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is ethyl 2-[(4-indol-1-yl-4-oxobutanoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(4-indol-1-yl-4-oxobutanoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 84561256 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | ethyl 2-[(4-indol-1-yl-4-oxobutanoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCC(=O)n2ccc3ccccc32)sc2c1CCCC2 |
| InChI | InChI=1S/C23H24N2O4S/c1-2-29-23(28)21-16-8-4-6-10-18(16)30-22(21)24-19(26)11-12-20(27)25-14-13-15-7-3-5-9-17(15)25/h3,5,7,9,13-14H,2,4,6,8,10-12H2,1H3,(H,24,26) |
| InChIKey | BFOHJMBCKUDBGX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'} |
|---|