C20H20N2O5 — CID 84562879
2-(1,3-dioxoisoindol-2-yl)-N-[2-hydroxy-3-(2-methylphenoxy)propyl]acetamide (PubChem CID 84562879) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[2-hydroxy-3-(2-methylphenoxy)propyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-hydroxy-3-(2-methylphenoxy)propyl]acetamide |
|---|---|
| PubChem CID | 84562879 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-hydroxy-3-(2-methylphenoxy)propyl]acetamide |
| SMILES | Cc1ccccc1OCC(O)CNC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H20N2O5/c1-13-6-2-5-9-17(13)27-12-14(23)10-21-18(24)11-22-19(25)15-7-3-4-8-16(15)20(22)26/h2-9,14,23H,10-12H2,1H3,(H,21,24) |
| InChIKey | SQTDJGOKWFRYFQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|