C19H24N4O3S — CID 84563681
1-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(2-hydroxyphenyl)piperidine-3-carboxamide (PubChem CID 84563681) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(2-hydroxyphenyl)piperidine-3-carboxamide.
| Compound Name | 1-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(2-hydroxyphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 84563681 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(2-hydroxyphenyl)piperidine-3-carboxamide |
| SMILES | Cc1nc(NC(=O)CN2CCCC(C(=O)Nc3ccccc3O)C2)sc1C |
| InChI | InChI=1S/C19H24N4O3S/c1-12-13(2)27-19(20-12)22-17(25)11-23-9-5-6-14(10-23)18(26)21-15-7-3-4-8-16(15)24/h3-4,7-8,14,24H,5-6,9-11H2,1-2H3,(H,21,26)(H,20,22,25) |
| InChIKey | IRUNUMXISHTAJO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|