C19H22ClN5O4S — CID 84564166
N-(4-chloro-2-nitrophenyl)-1-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]piperidine-3-carboxamide (PubChem CID 84564166) has the molecular formula C19H22ClN5O4S and a molecular weight of 451.94 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-1-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]piperidine-3-carboxamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-1-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 84564166 |
| Molecular Formula | C19H22ClN5O4S |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-1-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]piperidine-3-carboxamide |
| SMILES | Cc1nc(NC(=O)CN2CCCC(C(=O)Nc3ccc(Cl)cc3[N+](=O)[O-])C2)sc1C |
| InChI | InChI=1S/C19H22ClN5O4S/c1-11-12(2)30-19(21-11)23-17(26)10-24-7-3-4-13(9-24)18(27)22-15-6-5-14(20)8-16(15)25(28)29/h5-6,8,13H,3-4,7,9-10H2,1-2H3,(H,22,27)(H,21,23,26) |
| InChIKey | JBTFOURKIRLMIM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|