C17H26N4O — CID 84565905
N-[4-(dimethylamino)butyl]-3-(2-methylimidazo[1,2-a]pyridin-3-yl)propanamide (PubChem CID 84565905) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[4-(dimethylamino)butyl]-3-(2-methylimidazo[1,2-a]pyridin-3-yl)propanamide.
| Compound Name | N-[4-(dimethylamino)butyl]-3-(2-methylimidazo[1,2-a]pyridin-3-yl)propanamide |
|---|---|
| PubChem CID | 84565905 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | N-[4-(dimethylamino)butyl]-3-(2-methylimidazo[1,2-a]pyridin-3-yl)propanamide |
| SMILES | Cc1nc2ccccn2c1CCC(=O)NCCCCN(C)C |
| InChI | InChI=1S/C17H26N4O/c1-14-15(21-13-6-4-8-16(21)19-14)9-10-17(22)18-11-5-7-12-20(2)3/h4,6,8,13H,5,7,9-12H2,1-3H3,(H,18,22) |
| InChIKey | BFYWCDCWRXAUPW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|