C17H21N3O — CID 84565916
3-(2-methylimidazo[1,2-a]pyridin-3-yl)-N,N-bis(prop-2-enyl)propanamide (PubChem CID 84565916) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-(2-methylimidazo[1,2-a]pyridin-3-yl)-N,N-bis(prop-2-enyl)propanamide.
| Compound Name | 3-(2-methylimidazo[1,2-a]pyridin-3-yl)-N,N-bis(prop-2-enyl)propanamide |
|---|---|
| PubChem CID | 84565916 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-(2-methylimidazo[1,2-a]pyridin-3-yl)-N,N-bis(prop-2-enyl)propanamide |
| SMILES | C=CCN(CC=C)C(=O)CCc1c(C)nc2ccccn12 |
| InChI | InChI=1S/C17H21N3O/c1-4-11-19(12-5-2)17(21)10-9-15-14(3)18-16-8-6-7-13-20(15)16/h4-8,13H,1-2,9-12H2,3H3 |
| InChIKey | PUZFBDYWUXXLJZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|