C22H27N3O3 — CID 84566689
3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-(4-hydroxyphenyl)propanamide (PubChem CID 84566689) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-(4-hydroxyphenyl)propanamide.
| Compound Name | 3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 84566689 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-(4-hydroxyphenyl)propanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(CCC(=O)Nc1ccc(O)cc1)C1CC1 |
| InChI | InChI=1S/C22H27N3O3/c1-15-4-3-5-16(2)22(15)24-21(28)14-25(18-8-9-18)13-12-20(27)23-17-6-10-19(26)11-7-17/h3-7,10-11,18,26H,8-9,12-14H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | XUODZIWKCPAYNH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|