C26H36N4O2 — CID 84566697
3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-[4-(diethylamino)phenyl]propanamide (PubChem CID 84566697) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-[4-(diethylamino)phenyl]propanamide.
| Compound Name | 3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-[4-(diethylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 84566697 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-[4-(diethylamino)phenyl]propanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CCN(CC(=O)Nc2c(C)cccc2C)C2CC2)cc1 |
| InChI | InChI=1S/C26H36N4O2/c1-5-29(6-2)22-12-10-21(11-13-22)27-24(31)16-17-30(23-14-15-23)18-25(32)28-26-19(3)8-7-9-20(26)4/h7-13,23H,5-6,14-18H2,1-4H3,(H,27,31)(H,28,32) |
| InChIKey | OUINFSWZJWYAOC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|