C27H38N4O2 — CID 84567286
3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-[4-(diethylamino)-2-methylphenyl]propanamide (PubChem CID 84567286) has the molecular formula C27H38N4O2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-[4-(diethylamino)-2-methylphenyl]propanamide.
| Compound Name | 3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-[4-(diethylamino)-2-methylphenyl]propanamide |
|---|---|
| PubChem CID | 84567286 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-[4-(diethylamino)-2-methylphenyl]propanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CCN(CC(=O)Nc2c(C)cccc2C)C2CC2)c(C)c1 |
| InChI | InChI=1S/C27H38N4O2/c1-6-30(7-2)23-13-14-24(21(5)17-23)28-25(32)15-16-31(22-11-12-22)18-26(33)29-27-19(3)9-8-10-20(27)4/h8-10,13-14,17,22H,6-7,11-12,15-16,18H2,1-5H3,(H,28,32)(H,29,33) |
| InChIKey | IGVUSHYFHQMCOJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|