C23H28N4O4 — CID 84567705
3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-(2-methyl-3-nitrophenyl)propanamide (PubChem CID 84567705) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-(2-methyl-3-nitrophenyl)propanamide.
| Compound Name | 3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-(2-methyl-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 84567705 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 3-[cyclopropyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-N-(2-methyl-3-nitrophenyl)propanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(CCC(=O)Nc1cccc([N+](=O)[O-])c1C)C1CC1 |
| InChI | InChI=1S/C23H28N4O4/c1-15-6-4-7-16(2)23(15)25-22(29)14-26(18-10-11-18)13-12-21(28)24-19-8-5-9-20(17(19)3)27(30)31/h4-9,18H,10-14H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | HQCGKKPGFQSVOH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|