C27H24N2O4 — CID 84571768
2,4-dimethyl-6-[2-(4-phenylmethoxyindol-1-yl)acetyl]-1,4-benzoxazin-3-one (PubChem CID 84571768) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2,4-dimethyl-6-[2-(4-phenylmethoxyindol-1-yl)acetyl]-1,4-benzoxazin-3-one.
| Compound Name | 2,4-dimethyl-6-[2-(4-phenylmethoxyindol-1-yl)acetyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 84571768 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2,4-dimethyl-6-[2-(4-phenylmethoxyindol-1-yl)acetyl]-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(C(=O)Cn3ccc4c(OCc5ccccc5)cccc43)cc2N(C)C1=O |
| InChI | InChI=1S/C27H24N2O4/c1-18-27(31)28(2)23-15-20(11-12-26(23)33-18)24(30)16-29-14-13-21-22(29)9-6-10-25(21)32-17-19-7-4-3-5-8-19/h3-15,18H,16-17H2,1-2H3 |
| InChIKey | VTWRYYVIKOVQCZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |