C11H21NO3 — CID 84575429
2-(oxetan-3-yl)-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 84575429) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-(oxetan-3-yl)-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-(oxetan-3-yl)-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 84575429 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2-(oxetan-3-yl)-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | CC(C)OCCCNC(=O)CC1COC1 |
| InChI | InChI=1S/C11H21NO3/c1-9(2)15-5-3-4-12-11(13)6-10-7-14-8-10/h9-10H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | IAJRYVZQLXYETP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|