C14H12N4O2 — CID 84577723
N-(2-hydroxyphenyl)-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide (PubChem CID 84577723) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 84577723 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-(2-hydroxyphenyl)-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide |
| SMILES | Cc1nnc2cc(C(=O)Nc3ccccc3O)ccn12 |
| InChI | InChI=1S/C14H12N4O2/c1-9-16-17-13-8-10(6-7-18(9)13)14(20)15-11-4-2-3-5-12(11)19/h2-8,19H,1H3,(H,15,20) |
| InChIKey | GLZTYNXRTIHHBJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|