C17H14Cl2N2O — CID 84580794
3,4-dichloro-N-[2-(1H-indol-6-yl)ethyl]benzamide (PubChem CID 84580794) has the molecular formula C17H14Cl2N2O and a molecular weight of 333.22 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(1H-indol-6-yl)ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(1H-indol-6-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 84580794 |
| Molecular Formula | C17H14Cl2N2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 3,4-dichloro-N-[2-(1H-indol-6-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccc2cc[nH]c2c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N2O/c18-14-4-3-13(10-15(14)19)17(22)21-7-5-11-1-2-12-6-8-20-16(12)9-11/h1-4,6,8-10,20H,5,7H2,(H,21,22) |
| InChIKey | YRCKECVLVMQJGA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |