C16H17ClN2O3 — CID 84580916
6-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]pyridine-2-carboxamide (PubChem CID 84580916) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is 6-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 84580916 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 6-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]pyridine-2-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)c2cccc(Cl)n2)cc1OC |
| InChI | InChI=1S/C16H17ClN2O3/c1-10(11-7-8-13(21-2)14(9-11)22-3)18-16(20)12-5-4-6-15(17)19-12/h4-10H,1-3H3,(H,18,20) |
| InChIKey | ZIHQCJJCXQWDAF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|