C17H16Cl3NO4 — CID 112821206
2,3,5-trichloro-N-[1-(3,4-dimethoxyphenyl)ethyl]-6-hydroxybenzamide (PubChem CID 112821206) has the molecular formula C17H16Cl3NO4 and a molecular weight of 404.68 g/mol. Its IUPAC name is 2,3,5-trichloro-N-[1-(3,4-dimethoxyphenyl)ethyl]-6-hydroxybenzamide.
| Compound Name | 2,3,5-trichloro-N-[1-(3,4-dimethoxyphenyl)ethyl]-6-hydroxybenzamide |
|---|---|
| PubChem CID | 112821206 |
| Molecular Formula | C17H16Cl3NO4 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 2,3,5-trichloro-N-[1-(3,4-dimethoxyphenyl)ethyl]-6-hydroxybenzamide |
| SMILES | COc1ccc(C(C)NC(=O)c2c(O)c(Cl)cc(Cl)c2Cl)cc1OC |
| InChI | InChI=1S/C17H16Cl3NO4/c1-8(9-4-5-12(24-2)13(6-9)25-3)21-17(23)14-15(20)10(18)7-11(19)16(14)22/h4-8,22H,1-3H3,(H,21,23) |
| InChIKey | BNLWTFOVXNBFJV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|