C18H21NO4 — CID 134059754
N-[1-(3,4-dimethoxyphenyl)ethyl]-2-hydroxy-4-methylbenzamide (PubChem CID 134059754) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-2-hydroxy-4-methylbenzamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2-hydroxy-4-methylbenzamide |
|---|---|
| PubChem CID | 134059754 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2-hydroxy-4-methylbenzamide |
| SMILES | COc1ccc(C(C)NC(=O)c2ccc(C)cc2O)cc1OC |
| InChI | InChI=1S/C18H21NO4/c1-11-5-7-14(15(20)9-11)18(21)19-12(2)13-6-8-16(22-3)17(10-13)23-4/h5-10,12,20H,1-4H3,(H,19,21) |
| InChIKey | CSHKGIGHVXQQGM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |