C19H22N2O5 — CID 108510196
N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(2-hydroxy-4-methylphenyl)oxamide (PubChem CID 108510196) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(2-hydroxy-4-methylphenyl)oxamide.
| Compound Name | N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(2-hydroxy-4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108510196 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(2-hydroxy-4-methylphenyl)oxamide |
| SMILES | COc1ccc(C(C)NC(=O)C(=O)Nc2ccc(C)cc2O)cc1OC |
| InChI | InChI=1S/C19H22N2O5/c1-11-5-7-14(15(22)9-11)21-19(24)18(23)20-12(2)13-6-8-16(25-3)17(10-13)26-4/h5-10,12,22H,1-4H3,(H,20,23)(H,21,24) |
| InChIKey | YCOHGDVLELKWCB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|