C17H24N2O2 — CID 84585180
1-cyclobutyl-3-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-1-methylurea (PubChem CID 84585180) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-cyclobutyl-3-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-1-methylurea.
| Compound Name | 1-cyclobutyl-3-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 84585180 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-cyclobutyl-3-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-1-methylurea |
| SMILES | COc1ccccc1C1(CNC(=O)N(C)C2CCC2)CC1 |
| InChI | InChI=1S/C17H24N2O2/c1-19(13-6-5-7-13)16(20)18-12-17(10-11-17)14-8-3-4-9-15(14)21-2/h3-4,8-9,13H,5-7,10-12H2,1-2H3,(H,18,20) |
| InChIKey | XOUSHCCLSHTLIS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |