C18H28N2O2 — CID 110445118
1,1-diethyl-3-[[1-(2-methoxyphenyl)cyclopentyl]methyl]urea (PubChem CID 110445118) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1,1-diethyl-3-[[1-(2-methoxyphenyl)cyclopentyl]methyl]urea.
| Compound Name | 1,1-diethyl-3-[[1-(2-methoxyphenyl)cyclopentyl]methyl]urea |
|---|---|
| PubChem CID | 110445118 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1,1-diethyl-3-[[1-(2-methoxyphenyl)cyclopentyl]methyl]urea |
| SMILES | CCN(CC)C(=O)NCC1(c2ccccc2OC)CCCC1 |
| InChI | InChI=1S/C18H28N2O2/c1-4-20(5-2)17(21)19-14-18(12-8-9-13-18)15-10-6-7-11-16(15)22-3/h6-7,10-11H,4-5,8-9,12-14H2,1-3H3,(H,19,21) |
| InChIKey | QLTYBOIBWDVGRC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |